C5H12NO+ — CID 40503077
[(1S,2R)-2-hydroxycyclopentyl]azanium (PubChem CID 40503077) has the molecular formula C5H12NO+ and a molecular weight of 102.16 g/mol. Its IUPAC name is [(1S,2R)-2-hydroxycyclopentyl]azanium.
| Compound Name | [(1S,2R)-2-hydroxycyclopentyl]azanium |
|---|---|
| PubChem CID | 40503077 |
| Molecular Formula | C5H12NO+ |
| Molecular Weight | 102.16 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | [(1S,2R)-2-hydroxycyclopentyl]azanium |
| SMILES | [NH3+][C@H]1CCC[C@H]1O |
| InChI | InChI=1S/C5H11NO/c6-4-2-1-3-5(4)7/h4-5,7H,1-3,6H2/p+1/t4-,5+/m0/s1 |
| InChIKey | JFFOUICIRBXFRC-CRCLSJGQSA-O |
| XLogP | -0.86 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.16 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |