C5H9IO2 — CID 167184833
[(1R,2S)-2-hydroxycyclopentyl] hypoiodite (PubChem CID 167184833) has the molecular formula C5H9IO2 and a molecular weight of 228.03 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclopentyl] hypoiodite.
| Compound Name | [(1R,2S)-2-hydroxycyclopentyl] hypoiodite |
|---|---|
| PubChem CID | 167184833 |
| Molecular Formula | C5H9IO2 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 227.96 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclopentyl] hypoiodite |
| SMILES | O[C@H]1CCC[C@H]1OI |
| InChI | InChI=1S/C5H9IO2/c6-8-5-3-1-2-4(5)7/h4-5,7H,1-3H2/t4-,5+/m0/s1 |
| InChIKey | JRWJTAQZURCLDM-CRCLSJGQSA-N |
| XLogP | 1.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|