C9H16O2 — CID 131703611
trans-(1R,2R)-2-cyclobutyloxycyclopentan-1-ol (PubChem CID 131703611) has the molecular formula C9H16O2 and a molecular weight of 156.22 g/mol. Its IUPAC name is trans-(1R,2R)-2-cyclobutyloxycyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-cyclobutyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 131703611 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | trans-(1R,2R)-2-cyclobutyloxycyclopentan-1-ol |
| SMILES | O[C@@H]1CCC[C@H]1OC1CCC1 |
| InChI | InChI=1S/C9H16O2/c10-8-5-2-6-9(8)11-7-3-1-4-7/h7-10H,1-6H2/t8-,9-/m1/s1 |
| InChIKey | GNVRUBSLHLYGGQ-RKDXNWHRSA-N |
| XLogP | 1.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |