About (2-hydroxycycloheptyl) formate
(2-hydroxycycloheptyl) formate (PubChem CID 130142340) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is (2-hydroxycycloheptyl) formate.
Molecular Properties
| Compound Name | (2-hydroxycycloheptyl) formate |
| PubChem CID | 130142340 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (2-hydroxycycloheptyl) formate |
| SMILES | O=COC1CCCCCC1O |
| InChI | InChI=1S/C8H14O3/c9-6-11-8-5-3-1-2-4-7(8)10/h6-8,10H,1-5H2 |
| InChIKey | LIBXGODUAXOHIA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxycycloheptyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxycycloheptyl) formate?
The IUPAC name of (2-hydroxycycloheptyl) formate (CID 130142340) is (2-hydroxycycloheptyl) formate.
What is the SMILES notation for (2-hydroxycycloheptyl) formate?
The canonical SMILES for (2-hydroxycycloheptyl) formate is O=COC1CCCCCC1O.
What is the InChIKey of (2-hydroxycycloheptyl) formate?
The InChIKey is LIBXGODUAXOHIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c9-6-11-8-5-3-1-2-4-7(8)10/h6-8,10H,1-5H2.
What are the key properties of (2-hydroxycycloheptyl) formate?
(2-hydroxycycloheptyl) formate has a molecular weight of 158.20 g/mol, XLogP of 0.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxycycloheptyl) formate is sourced from PubChem (CID 130142340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).