C7H13NO2 — CID 87077504
[(1S,2S)-2-aminocyclohexyl] formate (PubChem CID 87077504) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is [(1S,2S)-2-aminocyclohexyl] formate.
| Compound Name | [(1S,2S)-2-aminocyclohexyl] formate |
|---|---|
| PubChem CID | 87077504 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | [(1S,2S)-2-aminocyclohexyl] formate |
| SMILES | N[C@H]1CCCC[C@@H]1OC=O |
| InChI | InChI=1S/C7H13NO2/c8-6-3-1-2-4-7(6)10-5-9/h5-7H,1-4,8H2/t6-,7-/m0/s1 |
| InChIKey | LZUAXBIQBOHKMA-BQBZGAKWSA-N |
| XLogP | 0.43 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|