About [(1R,2R)-2-aminocyclohexyl] carbamate
[(1R,2R)-2-aminocyclohexyl] carbamate (PubChem CID 145235379) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is [(1R,2R)-2-aminocyclohexyl] carbamate.
Molecular Properties
| Compound Name | [(1R,2R)-2-aminocyclohexyl] carbamate |
| PubChem CID | 145235379 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | [(1R,2R)-2-aminocyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C7H14N2O2/c8-5-3-1-2-4-6(5)11-7(9)10/h5-6H,1-4,8H2,(H2,9,10)/t5-,6-/m1/s1 |
| InChIKey | IQNKSDAFUZKPMM-PHDIDXHHSA-N |
| XLogP | 0.35 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2R)-2-aminocyclohexyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R)-2-aminocyclohexyl] carbamate?
The IUPAC name of [(1R,2R)-2-aminocyclohexyl] carbamate (CID 145235379) is [(1R,2R)-2-aminocyclohexyl] carbamate.
What is the SMILES notation for [(1R,2R)-2-aminocyclohexyl] carbamate?
The canonical SMILES for [(1R,2R)-2-aminocyclohexyl] carbamate is NC(=O)O[C@@H]1CCCC[C@H]1N.
What is the InChIKey of [(1R,2R)-2-aminocyclohexyl] carbamate?
The InChIKey is IQNKSDAFUZKPMM-PHDIDXHHSA-N. The full InChI is InChI=1S/C7H14N2O2/c8-5-3-1-2-4-6(5)11-7(9)10/h5-6H,1-4,8H2,(H2,9,10)/t5-,6-/m1/s1.
What are the key properties of [(1R,2R)-2-aminocyclohexyl] carbamate?
[(1R,2R)-2-aminocyclohexyl] carbamate has a molecular weight of 158.20 g/mol, XLogP of 0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R)-2-aminocyclohexyl] carbamate is sourced from PubChem (CID 145235379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).