C9H17NO3 — CID 70041811
[(1R,2S)-2-aminocyclohexyl] ethyl carbonate (PubChem CID 70041811) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is [(1R,2S)-2-aminocyclohexyl] ethyl carbonate.
| Compound Name | [(1R,2S)-2-aminocyclohexyl] ethyl carbonate |
|---|---|
| PubChem CID | 70041811 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | [(1R,2S)-2-aminocyclohexyl] ethyl carbonate |
| SMILES | CCOC(=O)O[C@@H]1CCCC[C@@H]1N |
| InChI | InChI=1S/C9H17NO3/c1-2-12-9(11)13-8-6-4-3-5-7(8)10/h7-8H,2-6,10H2,1H3/t7-,8+/m0/s1 |
| InChIKey | ZHNWEXASMHHSRE-JGVFFNPUSA-N |
| XLogP | 1.43 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |