C10H22N+ — CID 7740789
[(1S,2S)-2-tert-butylcyclohexyl]azanium (PubChem CID 7740789) has the molecular formula C10H22N+ and a molecular weight of 156.29 g/mol. Its IUPAC name is [(1S,2S)-2-tert-butylcyclohexyl]azanium.
| Compound Name | [(1S,2S)-2-tert-butylcyclohexyl]azanium |
|---|---|
| PubChem CID | 7740789 |
| Molecular Formula | C10H22N+ |
| Molecular Weight | 156.29 g/mol |
| Exact Mass | 156.17 |
| IUPAC Name | [(1S,2S)-2-tert-butylcyclohexyl]azanium |
| SMILES | CC(C)(C)[C@@H]1CCCC[C@@H]1[NH3+] |
| InChI | InChI=1S/C10H21N/c1-10(2,3)8-6-4-5-7-9(8)11/h8-9H,4-7,11H2,1-3H3/p+1/t8-,9+/m1/s1 |
| InChIKey | GEYTUFUSXAMSQK-BDAKNGLRSA-O |
| XLogP | 1.83 |
| TPSA | 27.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.29 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |