C11H22 — CID 102398260
trans-(1R,2R)-1-tert-butyl-2-methylcyclohexane (PubChem CID 102398260) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is trans-(1R,2R)-1-tert-butyl-2-methylcyclohexane.
| Compound Name | trans-(1R,2R)-1-tert-butyl-2-methylcyclohexane |
|---|---|
| PubChem CID | 102398260 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | trans-(1R,2R)-1-tert-butyl-2-methylcyclohexane |
| SMILES | C[C@@H]1CCCC[C@H]1C(C)(C)C |
| InChI | InChI=1S/C11H22/c1-9-7-5-6-8-10(9)11(2,3)4/h9-10H,5-8H2,1-4H3/t9-,10-/m1/s1 |
| InChIKey | VHAMEZDBTNFIIU-NXEZZACHSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |