C6H15N2O3+ — CID 5193005
(5-amino-2,3,4-trihydroxycyclohexyl)azanium (PubChem CID 5193005) has the molecular formula C6H15N2O3+ and a molecular weight of 163.20 g/mol. Its IUPAC name is (5-amino-2,3,4-trihydroxycyclohexyl)azanium.
| Compound Name | (5-amino-2,3,4-trihydroxycyclohexyl)azanium |
|---|---|
| PubChem CID | 5193005 |
| Molecular Formula | C6H15N2O3+ |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | (5-amino-2,3,4-trihydroxycyclohexyl)azanium |
| SMILES | NC1CC([NH3+])C(O)C(O)C1O |
| InChI | InChI=1S/C6H14N2O3/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,9-11H,1,7-8H2/p+1 |
| InChIKey | DTFAJAKTSMLKAT-UHFFFAOYSA-O |
| XLogP | -3.59 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |