C20H42N4O6 — CID 177466468
(1S,2R,3R,4S,6R)-4,6-diamino-3-[8-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoctoxy]cyclohexane-1,2-diol (PubChem CID 177466468) has the molecular formula C20H42N4O6 and a molecular weight of 434.58 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diamino-3-[8-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoctoxy]cyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[8-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoctoxy]cyclohexane-1,2-diol |
|---|---|
| PubChem CID | 177466468 |
| Molecular Formula | C20H42N4O6 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.31 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diamino-3-[8-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoctoxy]cyclohexane-1,2-diol |
| SMILES | N[C@@H]1C[C@H](N)[C@@H](OCCCCCCCCO[C@H]2[C@H](O)[C@@H](O)[C@H](N)C[C@@H]2N)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C20H42N4O6/c21-11-9-13(23)19(17(27)15(11)25)29-7-5-3-1-2-4-6-8-30-20-14(24)10-12(22)16(26)18(20)28/h11-20,25-28H,1-10,21-24H2/t11-,12-,13+,14+,15+,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | LLDVQFWELBGULN-KPUDSNMQSA-N |
| XLogP | -2.34 |
| TPSA | 203.46 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|