C10H20O7 — CID 90887918
(1R,2R,4S,5R)-6-(4-hydroxybutoxy)cyclohexane-1,2,3,4,5-pentol (PubChem CID 90887918) has the molecular formula C10H20O7 and a molecular weight of 252.26 g/mol. Its IUPAC name is (1R,2R,4S,5R)-6-(4-hydroxybutoxy)cyclohexane-1,2,3,4,5-pentol.
| Compound Name | (1R,2R,4S,5R)-6-(4-hydroxybutoxy)cyclohexane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 90887918 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1R,2R,4S,5R)-6-(4-hydroxybutoxy)cyclohexane-1,2,3,4,5-pentol |
| SMILES | OCCCCOC1[C@H](O)[C@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H20O7/c11-3-1-2-4-17-10-8(15)6(13)5(12)7(14)9(10)16/h5-16H,1-4H2/t5?,6-,7+,8-,9-,10?/m1/s1 |
| InChIKey | XGJRRYSPOFIICK-CHTZHWSWSA-N |
| XLogP | -3.04 |
| TPSA | 130.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -3.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|