C19H28O12 — CID 123416925
[2,3,4,5-tetraacetyloxy-6-(3-hydroxypropoxy)cyclohexyl] acetate (PubChem CID 123416925) has the molecular formula C19H28O12 and a molecular weight of 448.42 g/mol. Its IUPAC name is [2,3,4,5-tetraacetyloxy-6-(3-hydroxypropoxy)cyclohexyl] acetate.
| Compound Name | [2,3,4,5-tetraacetyloxy-6-(3-hydroxypropoxy)cyclohexyl] acetate |
|---|---|
| PubChem CID | 123416925 |
| Molecular Formula | C19H28O12 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [2,3,4,5-tetraacetyloxy-6-(3-hydroxypropoxy)cyclohexyl] acetate |
| SMILES | CC(=O)OC1C(OCCCO)C(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C19H28O12/c1-9(21)27-15-14(26-8-6-7-20)16(28-10(2)22)18(30-12(4)24)19(31-13(5)25)17(15)29-11(3)23/h14-20H,6-8H2,1-5H3 |
| InChIKey | LMKHQEFOPNQOHU-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 160.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|