C21H30O13 — CID 123942490
[2,3,4,5,6-pentaacetyloxy-4-(3-hydroxypropyl)cyclohexyl] acetate (PubChem CID 123942490) has the molecular formula C21H30O13 and a molecular weight of 490.46 g/mol. Its IUPAC name is [2,3,4,5,6-pentaacetyloxy-4-(3-hydroxypropyl)cyclohexyl] acetate.
| Compound Name | [2,3,4,5,6-pentaacetyloxy-4-(3-hydroxypropyl)cyclohexyl] acetate |
|---|---|
| PubChem CID | 123942490 |
| Molecular Formula | C21H30O13 |
| Molecular Weight | 490.46 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | [2,3,4,5,6-pentaacetyloxy-4-(3-hydroxypropyl)cyclohexyl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)C(OC(C)=O)C(CCCO)(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H30O13/c1-10(23)29-16-17(30-11(2)24)19(32-13(4)26)21(8-7-9-22,34-15(6)28)20(33-14(5)27)18(16)31-12(3)25/h16-20,22H,7-9H2,1-6H3 |
| InChIKey | RUVGZQJEZALUJX-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 178.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.46 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|