C23H36O13 — CID 90443558
[(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxy-5-(2-butoxyethoxymethyl)oxan-2-yl]methyl acetate (PubChem CID 90443558) has the molecular formula C23H36O13 and a molecular weight of 520.53 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxy-5-(2-butoxyethoxymethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxy-5-(2-butoxyethoxymethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 90443558 |
| Molecular Formula | C23H36O13 |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxy-5-(2-butoxyethoxymethyl)oxan-2-yl]methyl acetate |
| SMILES | CCCCOCCOC[C@@]1(OC(C)=O)C(OC(C)=O)O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H36O13/c1-7-8-9-29-10-11-30-13-23(36-18(6)28)21(33-16(4)26)20(32-15(3)25)19(12-31-14(2)24)35-22(23)34-17(5)27/h19-22H,7-13H2,1-6H3/t19-,20-,21+,22?,23+/m1/s1 |
| InChIKey | MSYNONHMSXVWCE-XNMMWTQGSA-N |
| XLogP | 0.84 |
| TPSA | 159.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|