C16H25FO8 — CID 130425865
[(2R)-4,5-diacetyloxy-2-(butoxymethyl)-4-(fluoromethyl)oxolan-3-yl] acetate (PubChem CID 130425865) has the molecular formula C16H25FO8 and a molecular weight of 364.37 g/mol. Its IUPAC name is [(2R)-4,5-diacetyloxy-2-(butoxymethyl)-4-(fluoromethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R)-4,5-diacetyloxy-2-(butoxymethyl)-4-(fluoromethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 130425865 |
| Molecular Formula | C16H25FO8 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | [(2R)-4,5-diacetyloxy-2-(butoxymethyl)-4-(fluoromethyl)oxolan-3-yl] acetate |
| SMILES | CCCCOC[C@H]1OC(OC(C)=O)C(CF)(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C16H25FO8/c1-5-6-7-21-8-13-14(22-10(2)18)16(9-17,25-12(4)20)15(24-13)23-11(3)19/h13-15H,5-9H2,1-4H3/t13-,14?,15?,16?/m1/s1 |
| InChIKey | FVLUXFZONWWODY-JYLOXXHMSA-N |
| XLogP | 1.29 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|