C15H24O9 — CID 123811631
[(2R,3R,4S)-4,5-diacetyloxy-3-butoxy-3-hydroxyoxolan-2-yl]methyl acetate (PubChem CID 123811631) has the molecular formula C15H24O9 and a molecular weight of 348.35 g/mol. Its IUPAC name is [(2R,3R,4S)-4,5-diacetyloxy-3-butoxy-3-hydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S)-4,5-diacetyloxy-3-butoxy-3-hydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123811631 |
| Molecular Formula | C15H24O9 |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | [(2R,3R,4S)-4,5-diacetyloxy-3-butoxy-3-hydroxyoxolan-2-yl]methyl acetate |
| SMILES | CCCCO[C@]1(O)[C@@H](COC(C)=O)OC(OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H24O9/c1-5-6-7-21-15(19)12(8-20-9(2)16)24-14(23-11(4)18)13(15)22-10(3)17/h12-14,19H,5-8H2,1-4H3/t12-,13+,14?,15-/m1/s1 |
| InChIKey | KPQIFTVKTPQKDE-IZGVIRRGSA-N |
| XLogP | 0.27 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|