C16H22O13 — CID 132917873
[(2R,3S,4R,5R,6S)-4,5,6-triacetyloxy-3-acetylperoxy-3-hydroxyoxan-2-yl]methyl acetate (PubChem CID 132917873) has the molecular formula C16H22O13 and a molecular weight of 422.34 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-4,5,6-triacetyloxy-3-acetylperoxy-3-hydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-4,5,6-triacetyloxy-3-acetylperoxy-3-hydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 132917873 |
| Molecular Formula | C16H22O13 |
| Molecular Weight | 422.34 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-4,5,6-triacetyloxy-3-acetylperoxy-3-hydroxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@]1(O)OOC(C)=O |
| InChI | InChI=1S/C16H22O13/c1-7(17)23-6-12-16(22,29-28-11(5)21)14(25-9(3)19)13(24-8(2)18)15(27-12)26-10(4)20/h12-15,22H,6H2,1-5H3/t12-,13-,14-,15-,16+/m1/s1 |
| InChIKey | WKRLSMOWUTUUJZ-QCODTGAPSA-N |
| XLogP | -1.12 |
| TPSA | 170.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.34 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|