C13H20O8 — CID 70667370
[(2R,3R,4R,5S)-4,5-diacetyloxy-3-methoxy-3-methyloxolan-2-yl]methyl acetate (PubChem CID 70667370) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-4,5-diacetyloxy-3-methoxy-3-methyloxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S)-4,5-diacetyloxy-3-methoxy-3-methyloxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 70667370 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [(2R,3R,4R,5S)-4,5-diacetyloxy-3-methoxy-3-methyloxolan-2-yl]methyl acetate |
| SMILES | CO[C@]1(C)[C@@H](COC(C)=O)O[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O8/c1-7(14)18-6-10-13(4,17-5)11(19-8(2)15)12(21-10)20-9(3)16/h10-12H,6H2,1-5H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | NHOAGNJSDMALOB-YVECIDJPSA-N |
| XLogP | 0.17 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|