C15H18N2O8 — CID 7564742
[(2S,3S,5S,6R)-3,5-diacetyloxy-4,4-dicyano-6-methoxyoxan-2-yl]methyl acetate (PubChem CID 7564742) has the molecular formula C15H18N2O8 and a molecular weight of 354.32 g/mol. Its IUPAC name is [(2S,3S,5S,6R)-3,5-diacetyloxy-4,4-dicyano-6-methoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,5S,6R)-3,5-diacetyloxy-4,4-dicyano-6-methoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 7564742 |
| Molecular Formula | C15H18N2O8 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | [(2S,3S,5S,6R)-3,5-diacetyloxy-4,4-dicyano-6-methoxyoxan-2-yl]methyl acetate |
| SMILES | CO[C@@H]1O[C@@H](COC(C)=O)[C@@H](OC(C)=O)C(C#N)(C#N)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H18N2O8/c1-8(18)22-5-11-12(23-9(2)19)15(6-16,7-17)13(24-10(3)20)14(21-4)25-11/h11-14H,5H2,1-4H3/t11-,12+,13+,14+/m0/s1 |
| InChIKey | KLEUJFZFOTXPJK-REWJHTLYSA-N |
| XLogP | -0.18 |
| TPSA | 144.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|