C18H24O13 — CID 59841759
(3,3,4,5,6-pentaacetyloxyoxan-2-yl)methyl acetate (PubChem CID 59841759) has the molecular formula C18H24O13 and a molecular weight of 448.38 g/mol. Its IUPAC name is (3,3,4,5,6-pentaacetyloxyoxan-2-yl)methyl acetate.
| Compound Name | (3,3,4,5,6-pentaacetyloxyoxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 59841759 |
| Molecular Formula | C18H24O13 |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | (3,3,4,5,6-pentaacetyloxyoxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C18H24O13/c1-8(19)25-7-14-18(30-12(5)23,31-13(6)24)16(27-10(3)21)15(26-9(2)20)17(29-14)28-11(4)22/h14-17H,7H2,1-6H3 |
| InChIKey | AIMSNOYMQHFZEG-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 167.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|