C14H18Br2O9 — CID 23256639
[(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-5,6-dibromooxan-2-yl]methyl acetate (PubChem CID 23256639) has the molecular formula C14H18Br2O9 and a molecular weight of 490.10 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-5,6-dibromooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-5,6-dibromooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 23256639 |
| Molecular Formula | C14H18Br2O9 |
| Molecular Weight | 490.10 g/mol |
| Exact Mass | 487.93 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-3,4,5-triacetyloxy-5,6-dibromooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Br)[C@](Br)(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H18Br2O9/c1-6(17)21-5-10-11(22-7(2)18)12(23-8(3)19)14(16,13(15)24-10)25-9(4)20/h10-13H,5H2,1-4H3/t10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | LRWUFJVAPYZMIC-RKQHYHRCSA-N |
| XLogP | 1.19 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.10 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|