C12H16Br2O7 — CID 11026413
[(2R,3R,4S,5S,6R)-3,4-diacetyloxy-5,6-dibromooxan-2-yl]methyl acetate (PubChem CID 11026413) has the molecular formula C12H16Br2O7 and a molecular weight of 432.06 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-5,6-dibromooxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-5,6-dibromooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11026413 |
| Molecular Formula | C12H16Br2O7 |
| Molecular Weight | 432.06 g/mol |
| Exact Mass | 429.93 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-3,4-diacetyloxy-5,6-dibromooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](Br)[C@@H](Br)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C12H16Br2O7/c1-5(15)18-4-8-10(19-6(2)16)11(20-7(3)17)9(13)12(14)21-8/h8-12H,4H2,1-3H3/t8-,9+,10-,11-,12+/m1/s1 |
| InChIKey | NTYSKQNPDDHOBU-ROHXPCBUSA-N |
| XLogP | 1.30 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.06 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|