C12H16I2O7 — CID 135036479
(3,4-diacetyloxy-5,6-diiodooxan-2-yl)methyl acetate (PubChem CID 135036479) has the molecular formula C12H16I2O7 and a molecular weight of 526.06 g/mol. Its IUPAC name is (3,4-diacetyloxy-5,6-diiodooxan-2-yl)methyl acetate.
| Compound Name | (3,4-diacetyloxy-5,6-diiodooxan-2-yl)methyl acetate |
|---|---|
| PubChem CID | 135036479 |
| Molecular Formula | C12H16I2O7 |
| Molecular Weight | 526.06 g/mol |
| Exact Mass | 525.90 |
| IUPAC Name | (3,4-diacetyloxy-5,6-diiodooxan-2-yl)methyl acetate |
| SMILES | CC(=O)OCC1OC(I)C(I)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C12H16I2O7/c1-5(15)18-4-8-10(19-6(2)16)11(20-7(3)17)9(13)12(14)21-8/h8-12H,4H2,1-3H3 |
| InChIKey | AZZBLQYJRUHNED-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|