C17H24HgO12 — CID 16683697
acetyloxy-[3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]mercury (PubChem CID 16683697) has the molecular formula C17H24HgO12 and a molecular weight of 620.96 g/mol. Its IUPAC name is acetyloxy-[3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]mercury.
| Compound Name | acetyloxy-[3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]mercury |
|---|---|
| PubChem CID | 16683697 |
| Molecular Formula | C17H24HgO12 |
| Molecular Weight | 620.96 g/mol |
| Exact Mass | 622.10 |
| IUPAC Name | acetyloxy-[3,4,5-triacetyloxy-6-(acetyloxymethyl)-2-methoxyoxan-3-yl]mercury |
| SMILES | COC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1(OC(C)=O)[Hg]OC(C)=O |
| InChI | InChI=1S/C15H21O10.C2H4O2.Hg/c1-7(16)21-6-11-12(22-8(2)17)13(23-9(3)18)14(24-10(4)19)15(20-5)25-11;1-2(3)4;/h11-13,15H,6H2,1-5H3;1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | TVOABGMBSXNVEA-UHFFFAOYSA-M |
| XLogP | -0.40 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.96 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|