C17H21NO11S — CID 134871594
[(2R,4R,5R,6R)-3,3,4,5-tetraacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate (PubChem CID 134871594) has the molecular formula C17H21NO11S and a molecular weight of 447.42 g/mol. Its IUPAC name is [(2R,4R,5R,6R)-3,3,4,5-tetraacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate.
| Compound Name | [(2R,4R,5R,6R)-3,3,4,5-tetraacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 134871594 |
| Molecular Formula | C17H21NO11S |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | [(2R,4R,5R,6R)-3,3,4,5-tetraacetyloxy-6-isothiocyanatooxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N=C=S)[C@H](OC(C)=O)[C@@H](OC(C)=O)C1(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H21NO11S/c1-8(19)24-6-13-17(28-11(4)22,29-12(5)23)15(26-10(3)21)14(25-9(2)20)16(27-13)18-7-30/h13-16H,6H2,1-5H3/t13-,14-,15-,16-/m1/s1 |
| InChIKey | NRDLXWKHMQPWLM-KLHDSHLOSA-N |
| XLogP | 0.06 |
| TPSA | 153.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|