C22H30O8 — CID 90441555
[(3S,4S,5R,6R)-2,3-diacetyloxy-6-ethyl-5-methyl-3-(phenylmethoxymethyl)oxan-4-yl] acetate (PubChem CID 90441555) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-2,3-diacetyloxy-6-ethyl-5-methyl-3-(phenylmethoxymethyl)oxan-4-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-2,3-diacetyloxy-6-ethyl-5-methyl-3-(phenylmethoxymethyl)oxan-4-yl] acetate |
|---|---|
| PubChem CID | 90441555 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(3S,4S,5R,6R)-2,3-diacetyloxy-6-ethyl-5-methyl-3-(phenylmethoxymethyl)oxan-4-yl] acetate |
| SMILES | CC[C@H]1OC(OC(C)=O)[C@@](COCc2ccccc2)(OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C22H30O8/c1-6-19-14(2)20(27-15(3)23)22(30-17(5)25,21(29-19)28-16(4)24)13-26-12-18-10-8-7-9-11-18/h7-11,14,19-21H,6,12-13H2,1-5H3/t14-,19-,20+,21?,22+/m1/s1 |
| InChIKey | NJLQQNXBJUOHQK-XHRDRQKJSA-N |
| XLogP | 2.77 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|