C22H28O10 — CID 123626996
[4,5,6-triacetyloxy-5-(phenylmethoxymethyl)oxan-2-yl]methyl acetate (PubChem CID 123626996) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is [4,5,6-triacetyloxy-5-(phenylmethoxymethyl)oxan-2-yl]methyl acetate.
| Compound Name | [4,5,6-triacetyloxy-5-(phenylmethoxymethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 123626996 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | [4,5,6-triacetyloxy-5-(phenylmethoxymethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1CC(OC(C)=O)C(COCc2ccccc2)(OC(C)=O)C(OC(C)=O)O1 |
| InChI | InChI=1S/C22H28O10/c1-14(23)28-12-19-10-20(29-15(2)24)22(32-17(4)26,21(31-19)30-16(3)25)13-27-11-18-8-6-5-7-9-18/h5-9,19-21H,10-13H2,1-4H3 |
| InChIKey | CGPLHRLPNKYZCK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|