C33H36O9 — CID 102507208
[(1R,3R,4R,5R,6R,7R)-7-acetyloxy-4,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate (PubChem CID 102507208) has the molecular formula C33H36O9 and a molecular weight of 576.64 g/mol. Its IUPAC name is [(1R,3R,4R,5R,6R,7R)-7-acetyloxy-4,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate.
| Compound Name | [(1R,3R,4R,5R,6R,7R)-7-acetyloxy-4,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate |
|---|---|
| PubChem CID | 102507208 |
| Molecular Formula | C33H36O9 |
| Molecular Weight | 576.64 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | [(1R,3R,4R,5R,6R,7R)-7-acetyloxy-4,6-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,8-dioxabicyclo[3.2.1]octan-3-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H]2O[C@@](COCc3ccccc3)([C@H](OCc3ccccc3)[C@H]2OC(C)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H36O9/c1-23(34)37-21-28-30(38-19-26-14-8-4-9-15-26)33(22-36-18-25-12-6-3-7-13-25)31(39-20-27-16-10-5-11-17-27)29(40-24(2)35)32(41-28)42-33/h3-17,28-32H,18-22H2,1-2H3/t28-,29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | YUFPUPQSRGMKRV-LNEPMPHRSA-N |
| XLogP | 4.36 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.64 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |