C26H30O9 — CID 66906843
[(2S,3S,4R,5R)-4,5-diacetyloxy-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate (PubChem CID 66906843) has the molecular formula C26H30O9 and a molecular weight of 486.52 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-4,5-diacetyloxy-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 66906843 |
| Molecular Formula | C26H30O9 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | [(2S,3S,4R,5R)-4,5-diacetyloxy-3-phenylmethoxy-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@]1(COCc2ccccc2)O[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30O9/c1-18(27)32-17-26(16-30-14-21-10-6-4-7-11-21)24(31-15-22-12-8-5-9-13-22)23(33-19(2)28)25(35-26)34-20(3)29/h4-13,23-25H,14-17H2,1-3H3/t23-,24+,25+,26+/m1/s1 |
| InChIKey | SGNUSNURWHZHHS-RSYZFUPGSA-N |
| XLogP | 2.94 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|