C25H29N3O7 — CID 135235571
[(3R,4S,5R)-2-acetyloxy-5-(1-azidoethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 135235571) has the molecular formula C25H29N3O7 and a molecular weight of 483.52 g/mol. Its IUPAC name is [(3R,4S,5R)-2-acetyloxy-5-(1-azidoethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(3R,4S,5R)-2-acetyloxy-5-(1-azidoethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 135235571 |
| Molecular Formula | C25H29N3O7 |
| Molecular Weight | 483.52 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [(3R,4S,5R)-2-acetyloxy-5-(1-azidoethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@](COCc2ccccc2)(C(C)N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H29N3O7/c1-17(27-28-26)25(16-31-14-20-10-6-4-7-11-20)23(32-15-21-12-8-5-9-13-21)22(33-18(2)29)24(35-25)34-19(3)30/h4-13,17,22-24H,14-16H2,1-3H3/t17?,22-,23+,24?,25+/m1/s1 |
| InChIKey | IRWODCYJTJMXGR-UCHWFNDTSA-N |
| XLogP | 4.08 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|