C25H30O10S — CID 58879645
[(3S,5S)-2-acetyloxy-5-(methylsulfonyloxymethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate (PubChem CID 58879645) has the molecular formula C25H30O10S and a molecular weight of 522.57 g/mol. Its IUPAC name is [(3S,5S)-2-acetyloxy-5-(methylsulfonyloxymethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(3S,5S)-2-acetyloxy-5-(methylsulfonyloxymethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 58879645 |
| Molecular Formula | C25H30O10S |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | [(3S,5S)-2-acetyloxy-5-(methylsulfonyloxymethyl)-4-phenylmethoxy-5-(phenylmethoxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1O[C@@](COCc2ccccc2)(COS(C)(=O)=O)C(OCc2ccccc2)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C25H30O10S/c1-18(26)33-22-23(31-15-21-12-8-5-9-13-21)25(17-32-36(3,28)29,35-24(22)34-19(2)27)16-30-14-20-10-6-4-7-11-20/h4-13,22-24H,14-17H2,1-3H3/t22-,23?,24?,25-/m0/s1 |
| InChIKey | DZNOYTCPAYPNAK-AATYUJHQSA-N |
| XLogP | 2.35 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|