C13H22O11S2 — CID 89495456
[(4R)-2-acetyloxy-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 89495456) has the molecular formula C13H22O11S2 and a molecular weight of 418.44 g/mol. Its IUPAC name is [(4R)-2-acetyloxy-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(4R)-2-acetyloxy-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 89495456 |
| Molecular Formula | C13H22O11S2 |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | [(4R)-2-acetyloxy-4-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CC(=O)OC1OC(COS(C)(=O)=O)(COS(C)(=O)=O)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C13H22O11S2/c1-8-11(22-9(2)14)12(23-10(3)15)24-13(8,6-20-25(4,16)17)7-21-26(5,18)19/h8,11-12H,6-7H2,1-5H3/t8-,11?,12?/m1/s1 |
| InChIKey | VHKGXPJXFRNUDM-HUUUCTMMSA-N |
| XLogP | -0.84 |
| TPSA | 148.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|