C16H22ClN5O6S — CID 118633386
[(2R,3R,4S)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 118633386) has the molecular formula C16H22ClN5O6S and a molecular weight of 447.90 g/mol. Its IUPAC name is [(2R,3R,4S)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4S)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 118633386 |
| Molecular Formula | C16H22ClN5O6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [(2R,3R,4S)-2-(2-amino-6-chloropurin-9-yl)-5-ethyl-4-methyl-5-(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CCC1(COS(C)(=O)=O)O[C@@H](n2cnc3c(Cl)nc(N)nc32)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C16H22ClN5O6S/c1-5-16(6-26-29(4,24)25)8(2)11(27-9(3)23)14(28-16)22-7-19-10-12(17)20-15(18)21-13(10)22/h7-8,11,14H,5-6H2,1-4H3,(H2,18,20,21)/t8-,11+,14+,16?/m0/s1 |
| InChIKey | DYRMMKGRXJULGQ-CAMJAJLSSA-N |
| XLogP | 1.28 |
| TPSA | 148.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|