C20H30ClN5O10S2 — CID 90125441
[(2R,4R)-2-(2-amino-6-chloropurin-9-yl)-4-butoxy-3-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate (PubChem CID 90125441) has the molecular formula C20H30ClN5O10S2 and a molecular weight of 600.07 g/mol. Its IUPAC name is [(2R,4R)-2-(2-amino-6-chloropurin-9-yl)-4-butoxy-3-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,4R)-2-(2-amino-6-chloropurin-9-yl)-4-butoxy-3-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 90125441 |
| Molecular Formula | C20H30ClN5O10S2 |
| Molecular Weight | 600.07 g/mol |
| Exact Mass | 599.11 |
| IUPAC Name | [(2R,4R)-2-(2-amino-6-chloropurin-9-yl)-4-butoxy-3-methyl-5,5-bis(methylsulfonyloxymethyl)oxolan-3-yl] acetate |
| SMILES | CCCCO[C@@H]1C(COS(C)(=O)=O)(COS(C)(=O)=O)O[C@@H](n2cnc3c(Cl)nc(N)nc32)C1(C)OC(C)=O |
| InChI | InChI=1S/C20H30ClN5O10S2/c1-6-7-8-32-16-19(3,35-12(2)27)17(26-11-23-13-14(21)24-18(22)25-15(13)26)36-20(16,9-33-37(4,28)29)10-34-38(5,30)31/h11,16-17H,6-10H2,1-5H3,(H2,22,24,25)/t16-,17+,19?/m0/s1 |
| InChIKey | RHVZLEYXMHFPRY-PZEDNMLSSA-N |
| XLogP | 0.79 |
| TPSA | 201.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.07 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|