C16H18ClN5O7 — CID 87843644
1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one (PubChem CID 87843644) has the molecular formula C16H18ClN5O7 and a molecular weight of 427.80 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 87843644 |
| Molecular Formula | C16H18ClN5O7 |
| Molecular Weight | 427.80 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(2-amino-6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one |
| SMILES | CC(=O)C(O)[C@H]1O[C@@H](n2cnc3c(Cl)nc(N)nc32)[C@@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C16H18ClN5O7/c1-5(23)9(26)10-15(27,6(2)24)16(28,7(3)25)13(29-10)22-4-19-8-11(17)20-14(18)21-12(8)22/h4,9-10,13,26-28H,1-3H3,(H2,18,20,21)/t9?,10-,13-,15-,16+/m1/s1 |
| InChIKey | SQHROEUROXHVQM-XIMQPBTOSA-N |
| XLogP | -1.45 |
| TPSA | 190.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.80 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |