C14H18N4O8 — CID 146156270
4-amino-1-[(3R,4R)-3,4-diacetyl-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 146156270) has the molecular formula C14H18N4O8 and a molecular weight of 370.32 g/mol. Its IUPAC name is 4-amino-1-[(3R,4R)-3,4-diacetyl-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(3R,4R)-3,4-diacetyl-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 146156270 |
| Molecular Formula | C14H18N4O8 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 4-amino-1-[(3R,4R)-3,4-diacetyl-3,4-dihydroxy-5-(1-hydroxy-2-oxopropyl)oxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | CC(=O)C(O)C1OC(n2cnc(N)nc2=O)[C@@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C14H18N4O8/c1-5(19)8(22)9-13(24,6(2)20)14(25,7(3)21)10(26-9)18-4-16-11(15)17-12(18)23/h4,8-10,22,24-25H,1-3H3,(H2,15,17,23)/t8?,9?,10?,13-,14+/m1/s1 |
| InChIKey | XLVFYWQZEYSISB-JRKIJIGBSA-N |
| XLogP | -3.29 |
| TPSA | 194.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | -3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |