C14H26F2N4O4Si2 — CID 140966159
4-amino-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-1,3,5-triazin-2-one (PubChem CID 140966159) has the molecular formula C14H26F2N4O4Si2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 4-amino-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-1,3,5-triazin-2-one.
| Compound Name | 4-amino-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 140966159 |
| Molecular Formula | C14H26F2N4O4Si2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-amino-1-[(2R,4S,5R)-3,3-difluoro-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-1,3,5-triazin-2-one |
| SMILES | C[Si](C)(C)C(O)[C@H]1O[C@@H](n2cnc(N)nc2=O)C(F)(F)[C@@]1(O)[Si](C)(C)C |
| InChI | InChI=1S/C14H26F2N4O4Si2/c1-25(2,3)9(21)8-14(23,26(4,5)6)13(15,16)10(24-8)20-7-18-11(17)19-12(20)22/h7-10,21,23H,1-6H3,(H2,17,19,22)/t8-,9?,10-,14+/m1/s1 |
| InChIKey | YILNROOJILNAPQ-VTWNZUCVSA-N |
| XLogP | 0.60 |
| TPSA | 123.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|