C22H34N4O6Si2 — CID 68580245
N-[5-[(2R,4R,5R)-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-2-phenoxyacetamide (PubChem CID 68580245) has the molecular formula C22H34N4O6Si2 and a molecular weight of 506.71 g/mol. Its IUPAC name is N-[5-[(2R,4R,5R)-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-2-phenoxyacetamide.
| Compound Name | N-[5-[(2R,4R,5R)-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 68580245 |
| Molecular Formula | C22H34N4O6Si2 |
| Molecular Weight | 506.71 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | N-[5-[(2R,4R,5R)-4-hydroxy-5-[hydroxy(trimethylsilyl)methyl]-4-trimethylsilyloxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-2-phenoxyacetamide |
| SMILES | C[Si](C)(C)C(O)[C@H]1O[C@@H](n2cnc(NC(=O)COc3ccccc3)nc2=O)C[C@@]1(O)[Si](C)(C)C |
| InChI | InChI=1S/C22H34N4O6Si2/c1-33(2,3)19(28)18-22(30,34(4,5)6)12-17(32-18)26-14-23-20(25-21(26)29)24-16(27)13-31-15-10-8-7-9-11-15/h7-11,14,17-19,28,30H,12-13H2,1-6H3,(H,24,25,27,29)/t17-,18-,19?,22-/m1/s1 |
| InChIKey | NPOFAFBMLGMQFX-WOYMVRNGSA-N |
| XLogP | 1.79 |
| TPSA | 135.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.71 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|