C17H20N3O10P — CID 158464255
[(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-4-[(2-phenoxyacetyl)amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 158464255) has the molecular formula C17H20N3O10P and a molecular weight of 457.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-4-[(2-phenoxyacetyl)amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-4-[(2-phenoxyacetyl)amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 158464255 |
| Molecular Formula | C17H20N3O10P |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-dihydroxy-5-[2-oxo-4-[(2-phenoxyacetyl)amino]pyrimidin-1-yl]oxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(COc1ccccc1)Nc1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C17H20N3O10P/c21-13(9-28-10-4-2-1-3-5-10)18-12-6-7-20(17(24)19-12)16-15(23)14(22)11(30-16)8-29-31(25,26)27/h1-7,11,14-16,22-23H,8-9H2,(H2,25,26,27)(H,18,19,21,24)/t11-,14-,15-,16-/m1/s1 |
| InChIKey | GEJHHXKTPWOMKS-RAEVTNRLSA-N |
| XLogP | -1.01 |
| TPSA | 189.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|