C16H17FN3O9P — CID 158464253
[(2R,3S,4R,5R)-5-[4-[(2-fluorobenzoyl)amino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 158464253) has the molecular formula C16H17FN3O9P and a molecular weight of 445.30 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[4-[(2-fluorobenzoyl)amino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-[4-[(2-fluorobenzoyl)amino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 158464253 |
| Molecular Formula | C16H17FN3O9P |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[4-[(2-fluorobenzoyl)amino]-2-oxopyrimidin-1-yl]-3,4-dihydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | O=C(Nc1ccn([C@@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1)c1ccccc1F |
| InChI | InChI=1S/C16H17FN3O9P/c17-9-4-2-1-3-8(9)14(23)18-11-5-6-20(16(24)19-11)15-13(22)12(21)10(29-15)7-28-30(25,26)27/h1-6,10,12-13,15,21-22H,7H2,(H2,25,26,27)(H,18,19,23,24)/t10-,12-,13-,15-/m1/s1 |
| InChIKey | PRYIOKABJKGMEW-BPGGGUHBSA-N |
| XLogP | -0.64 |
| TPSA | 180.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|