C21H25N5O4 — CID 91438087
N-[9-(3-methoxy-5-propyloxolan-2-yl)purin-6-yl]-2-phenoxyacetamide (PubChem CID 91438087) has the molecular formula C21H25N5O4 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-[9-(3-methoxy-5-propyloxolan-2-yl)purin-6-yl]-2-phenoxyacetamide.
| Compound Name | N-[9-(3-methoxy-5-propyloxolan-2-yl)purin-6-yl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 91438087 |
| Molecular Formula | C21H25N5O4 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-[9-(3-methoxy-5-propyloxolan-2-yl)purin-6-yl]-2-phenoxyacetamide |
| SMILES | CCCC1CC(OC)C(n2cnc3c(NC(=O)COc4ccccc4)ncnc32)O1 |
| InChI | InChI=1S/C21H25N5O4/c1-3-7-15-10-16(28-2)21(30-15)26-13-24-18-19(22-12-23-20(18)26)25-17(27)11-29-14-8-5-4-6-9-14/h4-6,8-9,12-13,15-16,21H,3,7,10-11H2,1-2H3,(H,22,23,25,27) |
| InChIKey | FAVZALOUVTVKEH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |