C38H34N11O11P — CID 100926846
[(2R,3R,4R,5R)-2-[bis(1,2,4-triazol-1-yl)phosphoryloxymethyl]-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]-4-(2-phenoxyacetyl)oxyoxolan-3-yl] 2-phenoxyacetate (PubChem CID 100926846) has the molecular formula C38H34N11O11P and a molecular weight of 851.73 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-[bis(1,2,4-triazol-1-yl)phosphoryloxymethyl]-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]-4-(2-phenoxyacetyl)oxyoxolan-3-yl] 2-phenoxyacetate.
| Compound Name | [(2R,3R,4R,5R)-2-[bis(1,2,4-triazol-1-yl)phosphoryloxymethyl]-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]-4-(2-phenoxyacetyl)oxyoxolan-3-yl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 100926846 |
| Molecular Formula | C38H34N11O11P |
| Molecular Weight | 851.73 g/mol |
| Exact Mass | 851.22 |
| IUPAC Name | [(2R,3R,4R,5R)-2-[bis(1,2,4-triazol-1-yl)phosphoryloxymethyl]-5-[6-[(2-phenoxyacetyl)amino]purin-9-yl]-4-(2-phenoxyacetyl)oxyoxolan-3-yl] 2-phenoxyacetate |
| SMILES | O=C(COc1ccccc1)Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(n2cncn2)n2cncn2)[C@@H](OC(=O)COc2ccccc2)[C@H]1OC(=O)COc1ccccc1 |
| InChI | InChI=1S/C38H34N11O11P/c50-30(17-54-26-10-4-1-5-11-26)46-36-33-37(42-22-41-36)47(25-43-33)38-35(60-32(52)19-56-28-14-8-3-9-15-28)34(59-31(51)18-55-27-12-6-2-7-13-27)29(58-38)16-57-61(53,48-23-39-20-44-48)49-24-40-21-45-49/h1-15,20-25,29,34-35,38H,16-19H2,(H,41,42,46,50)/t29-,34-,35-,38-/m1/s1 |
| InChIKey | JALCYDXYEQNAIN-UJTMRYLBSA-N |
| XLogP | 3.13 |
| TPSA | 249.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.73 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|