C24H28N5O10P — CID 10031073
[(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-[[ethoxy(phenoxy)phosphoryl]amino]purin-9-yl]oxolan-2-yl]methyl acetate (PubChem CID 10031073) has the molecular formula C24H28N5O10P and a molecular weight of 577.49 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-[[ethoxy(phenoxy)phosphoryl]amino]purin-9-yl]oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-[[ethoxy(phenoxy)phosphoryl]amino]purin-9-yl]oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10031073 |
| Molecular Formula | C24H28N5O10P |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | [(2R,3R,4R,5R)-3,4-diacetyloxy-5-[6-[[ethoxy(phenoxy)phosphoryl]amino]purin-9-yl]oxolan-2-yl]methyl acetate |
| SMILES | CCOP(=O)(Nc1ncnc2c1ncn2[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O)Oc1ccccc1 |
| InChI | InChI=1S/C24H28N5O10P/c1-5-35-40(33,39-17-9-7-6-8-10-17)28-22-19-23(26-12-25-22)29(13-27-19)24-21(37-16(4)32)20(36-15(3)31)18(38-24)11-34-14(2)30/h6-10,12-13,18,20-21,24H,5,11H2,1-4H3,(H,25,26,28,33)/t18-,20-,21-,24-,40?/m1/s1 |
| InChIKey | NSMVIRNCURXUNH-UGOZBVONSA-N |
| XLogP | 2.79 |
| TPSA | 179.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|