C16H17ClN4O7 — CID 87734767
1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one (PubChem CID 87734767) has the molecular formula C16H17ClN4O7 and a molecular weight of 412.79 g/mol. Its IUPAC name is 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one.
| Compound Name | 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one |
|---|---|
| PubChem CID | 87734767 |
| Molecular Formula | C16H17ClN4O7 |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 1-[(2R,3R,4R,5R)-3,4-diacetyl-5-(6-chloropurin-9-yl)-3,4-dihydroxyoxolan-2-yl]-1-hydroxypropan-2-one |
| SMILES | CC(=O)C(O)[C@H]1O[C@@H](n2cnc3c(Cl)ncnc32)[C@@](O)(C(C)=O)[C@@]1(O)C(C)=O |
| InChI | InChI=1S/C16H17ClN4O7/c1-6(22)10(25)11-15(26,7(2)23)16(27,8(3)24)14(28-11)21-5-20-9-12(17)18-4-19-13(9)21/h4-5,10-11,14,25-27H,1-3H3/t10?,11-,14-,15-,16+/m1/s1 |
| InChIKey | KSLORFPATKUJPF-NRMXZPFHSA-N |
| XLogP | -1.03 |
| TPSA | 164.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |