C12H14BrN5O5 — CID 54484299
1-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl]ethanone (PubChem CID 54484299) has the molecular formula C12H14BrN5O5 and a molecular weight of 388.18 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl]ethanone.
| Compound Name | 1-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl]ethanone |
|---|---|
| PubChem CID | 54484299 |
| Molecular Formula | C12H14BrN5O5 |
| Molecular Weight | 388.18 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-4-bromo-3,4-dihydroxy-5-(hydroxymethyl)oxolan-3-yl]ethanone |
| SMILES | CC(=O)[C@]1(O)[C@H](n2cnc3c(N)ncnc32)O[C@H](CO)[C@]1(O)Br |
| InChI | InChI=1S/C12H14BrN5O5/c1-5(20)11(21)10(23-6(2-19)12(11,13)22)18-4-17-7-8(14)15-3-16-9(7)18/h3-4,6,10,19,21-22H,2H2,1H3,(H2,14,15,16)/t6-,10-,11+,12-/m1/s1 |
| InChIKey | XRFDUBCCCSJBOD-IJJXPJNWSA-N |
| XLogP | -1.30 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.18 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|