C12H15N5O5S — CID 178182080
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-methoxyoxolane-3-carbothioic S-acid (PubChem CID 178182080) has the molecular formula C12H15N5O5S and a molecular weight of 341.35 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-methoxyoxolane-3-carbothioic S-acid.
| Compound Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-methoxyoxolane-3-carbothioic S-acid |
|---|---|
| PubChem CID | 178182080 |
| Molecular Formula | C12H15N5O5S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-2-(hydroxymethyl)-4-methoxyoxolane-3-carbothioic S-acid |
| SMILES | CO[C@H]1[C@H](n2cnc3c(N)ncnc32)O[C@H](CO)[C@]1(O)C(=O)S |
| InChI | InChI=1S/C12H15N5O5S/c1-21-7-10(22-5(2-18)12(7,20)11(19)23)17-4-16-6-8(13)14-3-15-9(6)17/h3-5,7,10,18,20H,2H2,1H3,(H,19,23)(H2,13,14,15)/t5-,7+,10-,12-/m1/s1 |
| InChIKey | GKOWFSNRIHEJHF-OEBFKYMWSA-N |
| XLogP | -1.50 |
| TPSA | 145.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|