C24H24N5O15P3 — CID 90740738
[(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-(4-benzoylbenzoyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate (PubChem CID 90740738) has the molecular formula C24H24N5O15P3 and a molecular weight of 715.40 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-(4-benzoylbenzoyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-(4-benzoylbenzoyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 90740738 |
| Molecular Formula | C24H24N5O15P3 |
| Molecular Weight | 715.40 g/mol |
| Exact Mass | 715.05 |
| IUPAC Name | [(2R,3R,4R,5R)-2-(6-aminopurin-9-yl)-4-(4-benzoylbenzoyl)-4-hydroxy-5-(hydroxymethyl)oxolan-3-yl] [hydroxy(phosphonooxy)phosphoryl] hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@](O)(C(=O)c2ccc(C(=O)c3ccccc3)cc2)[C@H]1OP(=O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C24H24N5O15P3/c25-21-17-22(27-11-26-21)29(12-28-17)23-20(42-46(37,38)44-47(39,40)43-45(34,35)36)24(33,16(10-30)41-23)19(32)15-8-6-14(7-9-15)18(31)13-4-2-1-3-5-13/h1-9,11-12,16,20,23,30,33H,10H2,(H,37,38)(H,39,40)(H2,25,26,27)(H2,34,35,36)/t16-,20+,23-,24+/m1/s1 |
| InChIKey | OMKJQFARZQDQEV-JLPBCEFPSA-N |
| XLogP | 0.86 |
| TPSA | 313.27 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|