C20H53N10O19P3 — CID 173051569
pentakis(2-aminoethanol);(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;diphosphono hydrogen phosphate (PubChem CID 173051569) has the molecular formula C20H53N10O19P3 and a molecular weight of 830.62 g/mol. Its IUPAC name is pentakis(2-aminoethanol);(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;diphosphono hydrogen phosphate.
| Compound Name | pentakis(2-aminoethanol);(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 173051569 |
| Molecular Formula | C20H53N10O19P3 |
| Molecular Weight | 830.62 g/mol |
| Exact Mass | 830.27 |
| IUPAC Name | pentakis(2-aminoethanol);(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol;diphosphono hydrogen phosphate |
| SMILES | NCCO.NCCO.NCCO.NCCO.NCCO.Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H13N5O4.5C2H7NO.H5O10P3/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10;5*3-1-2-4;1-11(2,3)9-13(7,8)10-12(4,5)6/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13);5*4H,1-3H2;(H,7,8)(H2,1,2,3)(H2,4,5,6)/t4-,6-,7-,10-;;;;;;/m1....../s1 |
| InChIKey | VCSAGTFUHDYZGE-QCSRICIXSA-N |
| XLogP | -7.99 |
| TPSA | 541.61 Ų |
| H-Bond Donors | 19 |
| H-Bond Acceptors | 24 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.62 |
| LogP ≤ 5 | -7.99 |
| H-Bond Donors ≤ 5 | 19 |
| H-Bond Acceptors ≤ 10 | 24 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|