C10H18N5O13P3 — CID 174741919
(2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;diphosphono hydrogen phosphate (PubChem CID 174741919) has the molecular formula C10H18N5O13P3 and a molecular weight of 509.20 g/mol. Its IUPAC name is (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;diphosphono hydrogen phosphate.
| Compound Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;diphosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174741919 |
| Molecular Formula | C10H18N5O13P3 |
| Molecular Weight | 509.20 g/mol |
| Exact Mass | 509.01 |
| IUPAC Name | (2R,3R,5S)-2-(6-aminopurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol;diphosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](CO)C[C@H]1O.O=P(O)(O)OP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C10H13N5O3.H5O10P3/c11-8-7-9(13-3-12-8)15(4-14-7)10-6(17)1-5(2-16)18-10;1-11(2,3)9-13(7,8)10-12(4,5)6/h3-6,10,16-17H,1-2H2,(H2,11,12,13);(H,7,8)(H2,1,2,3)(H2,4,5,6)/t5-,6+,10+;/m0./s1 |
| InChIKey | NTEUJWCSCBRZPA-BXXYBDJJSA-N |
| XLogP | -1.65 |
| TPSA | 290.13 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.20 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|